ChemNet > CAS > 249278-33-9 3- [2,3- 디 (벤질 옥시) 페닐] 프로판 니트릴
249278-33-9 3- [2,3- 디 (벤질 옥시) 페닐] 프로판 니트릴
상품명칭 |
3- [2,3- 디 (벤질 옥시) 페닐] 프로판 니트릴 |
별명 |
3- [2,3- 비스 (벤질 옥시) 페닐] 프로판 니트릴 |
영문 이름 |
3-[2,3-di(benzyloxy)phenyl]propanenitrile;3-[2,3-bis(benzyloxy)phenyl]propanenitrile |
분자식 |
C23H21NO2 |
분자량 |
343.4183 |
InChI |
InChI=1/C23H21NO2/c24-16-8-14-21-13-7-15-22(25-17-19-9-3-1-4-10-19)23(21)26-18-20-11-5-2-6-12-20/h1-7,9-13,15H,8,14,17-18H2 |
cas번호 |
249278-33-9 |
분자 구조 |
|
밀도 |
1.138g/cm3 |
녹는 점 |
200℃ |
비등점 |
525.9°C at 760 mmHg |
굴절 지수 |
1.596 |
인화점 |
174.5°C |
증기압 |
3.75E-11mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|